Products 2835125-62-5
CAS 2835125-62-5 is the registry number for 7-Chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 2835125-62-5) is a chemical compound with the molecular formula C10H9ClFNO2 and a molecular weight of 229.63 g/mol. IUPAC name: 7-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: BTRNARGFVUXZCL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFNO2 |
|---|---|
| Molecular weight | 229.63 g/mol |
| IUPAC name | 7-chloro-6-fluoro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | BTRNARGFVUXZCL-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C2C1C(=O)O)F)Cl |
Computed by PubChem (NCBI)