Products 1501246-61-2
CAS 1501246-61-2 is the registry number for 2-(Trifluoromethyl)-1,6-naphthyridin-4-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(trifluoromethyl)-1H-1,6-naphthyridin-4-one (CAS 1501246-61-2) is a chemical compound with the molecular formula C9H5F3N2O and a molecular weight of 214.14 g/mol. IUPAC name: 2-(trifluoromethyl)-1H-1,6-naphthyridin-4-one. InChIKey: DXDWHDUBRXVJSG-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O |
|---|---|
| Molecular weight | 214.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1H-1,6-naphthyridin-4-one |
| InChIKey | DXDWHDUBRXVJSG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1NC(=CC2=O)C(F)(F)F |
Computed by PubChem (NCBI)