CAS 1501980-29-5 appears in our catalog under these names: Avibactam Impurity 39, Avibactam Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid (CAS 1501980-29-5) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid. InChIKey: CDZNTXLXEGFPLP-NEPJUHHUSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxylic acid |
| InChIKey | CDZNTXLXEGFPLP-NEPJUHHUSA-N |
| SMILES | C1C[C@H](NC[C@@H]1NOCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)