CAS 1502076-74-5 is the registry number for 2-Amino-3-cyano-4,5,6,7-tetrahydrobenzo[b]thiophene-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-3-cyano-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid (CAS 1502076-74-5) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: 2-amino-3-cyano-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid. InChIKey: WPBTWLLUEYORHQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 2-amino-3-cyano-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid |
| InChIKey | WPBTWLLUEYORHQ-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)SC(=C2C#N)N)C(=O)O |
Computed by PubChem (NCBI)