CAS 2749964-03-0 is the registry number for (S)-2-Amino-3-cyano-4,5,6,7-tetrahydrobenzo[b]thiophene-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S)-2-amino-3-cyano-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid (CAS 2749964-03-0) is a chemical compound with the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. IUPAC name: (4S)-2-amino-3-cyano-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid. InChIKey: WPBTWLLUEYORHQ-YFKPBYRVSA-N.
| Molecular formula | C10H10N2O2S |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | (4S)-2-amino-3-cyano-4,5,6,7-tetrahydro-1-benzothiophene-4-carboxylic acid |
| InChIKey | WPBTWLLUEYORHQ-YFKPBYRVSA-N |
| SMILES | C1C[C@@H](C2=C(C1)SC(=C2C#N)N)C(=O)O |
Computed by PubChem (NCBI)