CAS 1502768-00-4 appears in our catalog under these names: 2-N-Methyl-2-N-((4-methylphenyl)methyl)-1,3-benzoxazole-2,5-diamine, 95%, 2-N-Methyl-2-N-((4-methylphenyl)methyl)-1,3-benzoxazole-2,5-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-N-methyl-2-N-[(4-methylphenyl)methyl]-1,3-benzoxazole-2,5-diamine (CAS 1502768-00-4) is a chemical compound with the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. IUPAC name: 2-N-methyl-2-N-[(4-methylphenyl)methyl]-1,3-benzoxazole-2,5-diamine. InChIKey: RNNHGFBTKKKCLX-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O |
|---|---|
| Molecular weight | 267.33 g/mol |
| IUPAC name | 2-N-methyl-2-N-[(4-methylphenyl)methyl]-1,3-benzoxazole-2,5-diamine |
| InChIKey | RNNHGFBTKKKCLX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN(C)C2=NC3=C(O2)C=CC(=C3)N |
Computed by PubChem (NCBI)