CAS 15032-43-6 is the registry number for Ethyl (4-chlorophenyl)cyanoacetate. Offered by: TRC. Available pack sizes: 5g.
Ethyl 2-(4-chlorophenyl)-2-cyanoacetate (CAS 15032-43-6) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: ethyl 2-(4-chlorophenyl)-2-cyanoacetate. InChIKey: NZMYLLIHPJDUNT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | ethyl 2-(4-chlorophenyl)-2-cyanoacetate |
| InChIKey | NZMYLLIHPJDUNT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)