Products 150320-81-3
CAS 150320-81-3 appears in our catalog under these names: 2-Amino-5-phenylpyridine-d5, 2–Amino–5–phenylpyridine–d5. Offered by: TRC, GLPBio. Available pack sizes: 1g, 100mg.
5-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-amine (CAS 150320-81-3) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 175.24 g/mol. IUPAC name: 5-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-amine. InChIKey: OAPVIBHQRYFYSE-RALIUCGRSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 175.24 g/mol |
| IUPAC name | 5-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-amine |
| InChIKey | OAPVIBHQRYFYSE-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CN=C(C=C2)N)[2H])[2H] |
Computed by PubChem (NCBI)