CAS 1503212-63-2 is the registry number for 6-(Ethoxycarbonyl)benzo[d]thiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethoxycarbonyl-1,3-benzothiazole-2-carboxylic acid (CAS 1503212-63-2) is a chemical compound with the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. IUPAC name: 6-ethoxycarbonyl-1,3-benzothiazole-2-carboxylic acid. InChIKey: WYESNFIGODAPRC-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 6-ethoxycarbonyl-1,3-benzothiazole-2-carboxylic acid |
| InChIKey | WYESNFIGODAPRC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=C(S2)C(=O)O |
Computed by PubChem (NCBI)