CAS 488823-77-4 appears in our catalog under these names: 3-[(2,4-Dioxo-1,3-thiazolidin-3-yl)methyl]benzoic acid, 95%, 3-((2,4-Dioxo-1,3-thiazolidin-3-yl)methyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoic acid (CAS 488823-77-4) is a chemical compound with the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. IUPAC name: 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoic acid. InChIKey: HPHIWARELRGSSC-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]benzoic acid |
| InChIKey | HPHIWARELRGSSC-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)S1)CC2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)