Products 1956366-84-9
CAS 1956366-84-9 appears in our catalog under these names: 6-(Methylsulfonyl)quinoline-3-carboxylic acid, 95%, 6-(Methylsulfonyl)quinoline-3-carboxylic Acid, 6-(Methylsulfonyl)quinoline-3-carboxylic acid, 95%, 95%, 6-(METHYLSULFONYL)QUINOLINE-3-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-methylsulfonylquinoline-3-carboxylic acid (CAS 1956366-84-9) is a chemical compound with the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. IUPAC name: 6-methylsulfonylquinoline-3-carboxylic acid. InChIKey: JZAQMAULCXPATI-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 6-methylsulfonylquinoline-3-carboxylic acid |
| InChIKey | JZAQMAULCXPATI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=CC(=CN=C2C=C1)C(=O)O |
Computed by PubChem (NCBI)