CAS 459421-21-7 is the registry number for 2-[(2,5-Dioxopyrrolidin-3-yl)thio]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid (CAS 459421-21-7) is a chemical compound with the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. IUPAC name: 2-(2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid. InChIKey: DGTHQWTWIDOTRD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4S |
|---|---|
| Molecular weight | 251.26 g/mol |
| IUPAC name | 2-(2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid |
| InChIKey | DGTHQWTWIDOTRD-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC1=O)SC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)