Products 459421-21-7

CAS 459421-21-7 is the registry number for 2-[(2,5-Dioxopyrrolidin-3-yl)thio]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid (CAS 459421-21-7) is a chemical compound with the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. IUPAC name: 2-(2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid. InChIKey: DGTHQWTWIDOTRD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO4S
Molecular weight251.26 g/mol
IUPAC name2-(2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid
InChIKeyDGTHQWTWIDOTRD-UHFFFAOYSA-N
SMILESC1C(C(=O)NC1=O)SC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)