CAS 150351-43-2 is the registry number for 3-bromo-2,6-dimethoxybenzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-2,6-dimethoxybenzamide (CAS 150351-43-2) is a chemical compound with the molecular formula C9H10BrNO3 and a molecular weight of 260.08 g/mol. IUPAC name: 3-bromo-2,6-dimethoxybenzamide. InChIKey: DPDQIKPORRDZJR-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO3 |
|---|---|
| Molecular weight | 260.08 g/mol |
| IUPAC name | 3-bromo-2,6-dimethoxybenzamide |
| InChIKey | DPDQIKPORRDZJR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)OC)C(=O)N |
Computed by PubChem (NCBI)