CAS 150351-65-8 appears in our catalog under these names: (2S)-2-[(tert-Butoxy)carbonylamino]-3-(4-phenoxyphenyl)propanoic acid, 97%, Boc-L-Tyr(Ph)-OH, (S)-2-((tert-Butoxycarbonyl)amino)-3-(4-phenoxyphenyl)propanoic acid, 97%, 97%, Boc-4-(phenoxy)-L-phenylalanine, 97%. Offered by: Combi-blocks, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenoxyphenyl)propanoic acid (CAS 150351-65-8) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenoxyphenyl)propanoic acid. InChIKey: IVLQWSYPQAZKEO-KRWDZBQOSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phenoxyphenyl)propanoic acid |
| InChIKey | IVLQWSYPQAZKEO-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)