Products 216094-54-1
CAS 216094-54-1 is the registry number for (Alphar,betas)-beta-(benzoylamino)-alpha-(1-ethoxyethoxy)benzenepropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R,3S)-3-benzamido-2-(1-ethoxyethoxy)-3-phenylpropanoic acid (CAS 216094-54-1) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: (2R,3S)-3-benzamido-2-(1-ethoxyethoxy)-3-phenylpropanoic acid. InChIKey: OKSZFAMAFLHYNJ-CXRLMVSZSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2R,3S)-3-benzamido-2-(1-ethoxyethoxy)-3-phenylpropanoic acid |
| InChIKey | OKSZFAMAFLHYNJ-CXRLMVSZSA-N |
| SMILES | CCOC(C)O[C@H]([C@H](C1=CC=CC=C1)NC(=O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)