Products 2397651-97-5
CAS 2397651-97-5 appears in our catalog under these names: 10α–hydroxy Naltrexone, Naltrexone, min. 95 %, impurity F, 5 mg, Naltrexone EP Inpurity F, Naltrexone EP Impurity F, 10Alpha-Hydroxy Naltrexone, >95% (HPLC). Offered by: GLPBio, Roth, Chemat Brand, TRC, Biosynth. Available pack sizes: 5mg, on request, 1mg, 500μg, 2mg, 25mg, 10mg, 100mg.
(4R,4aS,7aR,12bS,13S)-3-(cyclopropylmethyl)-4a,9,13-trihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (CAS 2397651-97-5) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: (4R,4aS,7aR,12bS,13S)-3-(cyclopropylmethyl)-4a,9,13-trihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one. InChIKey: SPLLFLBLAXVPPQ-AXDKOMKPSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (4R,4aS,7aR,12bS,13S)-3-(cyclopropylmethyl)-4a,9,13-trihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| InChIKey | SPLLFLBLAXVPPQ-AXDKOMKPSA-N |
| SMILES | C1CC1CN2CC[C@]34[C@@H]5C(=O)CC[C@]3([C@H]2[C@H](C6=C4C(=C(C=C6)O)O5)O)O |
Computed by PubChem (NCBI)