CAS 1777830-05-3 appears in our catalog under these names: Ketoprofen Impurity 44, Ketoprofen Tromethamine Amide, Ketoprofen Impurity 20, rac-Ketoprofen Tris Base Amide, >95% (HPLC), rac-Ketoprofen tris base amide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3-benzoylphenyl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]propanamide (CAS 1777830-05-3) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: 2-(3-benzoylphenyl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]propanamide. InChIKey: XLVOGCLORTXKJL-UHFFFAOYSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 2-(3-benzoylphenyl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]propanamide |
| InChIKey | XLVOGCLORTXKJL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)NC(CO)(CO)CO |
Computed by PubChem (NCBI)