Products 1503540-51-9
CAS 1503540-51-9 appears in our catalog under these names: 2-methyl-1-(propan-2-yl)-1H-1,3-benzodiazole-4-carboxylic acid, 95%, 1-Isopropyl-2-methyl-1H-benzo(d)imidazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-methyl-1-propan-2-ylbenzimidazole-4-carboxylic acid (CAS 1503540-51-9) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 2-methyl-1-propan-2-ylbenzimidazole-4-carboxylic acid. InChIKey: YJXZANQAPHRPEC-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-methyl-1-propan-2-ylbenzimidazole-4-carboxylic acid |
| InChIKey | YJXZANQAPHRPEC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC=C2N1C(C)C)C(=O)O |
Computed by PubChem (NCBI)