Products 1504599-35-2

CAS 1504599-35-2 is the registry number for 3-(Oxan-4-yl)propane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(oxan-4-yl)propane-1-sulfonyl chloride (CAS 1504599-35-2) is a chemical compound with the molecular formula C8H15ClO3S and a molecular weight of 226.72 g/mol. IUPAC name: 3-(oxan-4-yl)propane-1-sulfonyl chloride. InChIKey: PZOPEGDOQPYUSC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClO3S
Molecular weight226.72 g/mol
IUPAC name3-(oxan-4-yl)propane-1-sulfonyl chloride
InChIKeyPZOPEGDOQPYUSC-UHFFFAOYSA-N
SMILESC1COCCC1CCCS(=O)(=O)Cl

Computed by PubChem (NCBI)