Products 1934960-78-7

CAS 1934960-78-7 appears in our catalog under these names: (6,6-Dimethyloxan-2-yl)methanesulfonyl chloride, 95%, (6,6-Dimethyloxan-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.

(6,6-dimethyloxan-2-yl)methanesulfonyl chloride (CAS 1934960-78-7) is a chemical compound with the molecular formula C8H15ClO3S and a molecular weight of 226.72 g/mol. IUPAC name: (6,6-dimethyloxan-2-yl)methanesulfonyl chloride. InChIKey: OSVQXXNDTJPXDR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClO3S
Molecular weight226.72 g/mol
IUPAC name(6,6-dimethyloxan-2-yl)methanesulfonyl chloride
InChIKeyOSVQXXNDTJPXDR-UHFFFAOYSA-N
SMILESCC1(CCCC(O1)CS(=O)(=O)Cl)C

Computed by PubChem (NCBI)