CAS 1934960-78-7 appears in our catalog under these names: (6,6-Dimethyloxan-2-yl)methanesulfonyl chloride, 95%, (6,6-Dimethyloxan-2-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
(6,6-dimethyloxan-2-yl)methanesulfonyl chloride (CAS 1934960-78-7) is a chemical compound with the molecular formula C8H15ClO3S and a molecular weight of 226.72 g/mol. IUPAC name: (6,6-dimethyloxan-2-yl)methanesulfonyl chloride. InChIKey: OSVQXXNDTJPXDR-UHFFFAOYSA-N.
| Molecular formula | C8H15ClO3S |
|---|---|
| Molecular weight | 226.72 g/mol |
| IUPAC name | (6,6-dimethyloxan-2-yl)methanesulfonyl chloride |
| InChIKey | OSVQXXNDTJPXDR-UHFFFAOYSA-N |
| SMILES | CC1(CCCC(O1)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)