Products 1781128-20-8

CAS 1781128-20-8 appears in our catalog under these names: (1-Methoxycyclohexyl)methanesulfonyl chloride, 95%, (1-Methoxycyclohexyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

(1-methoxycyclohexyl)methanesulfonyl chloride (CAS 1781128-20-8) is a chemical compound with the molecular formula C8H15ClO3S and a molecular weight of 226.72 g/mol. IUPAC name: (1-methoxycyclohexyl)methanesulfonyl chloride. InChIKey: AGUFKLSJMGEQCP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClO3S
Molecular weight226.72 g/mol
IUPAC name(1-methoxycyclohexyl)methanesulfonyl chloride
InChIKeyAGUFKLSJMGEQCP-UHFFFAOYSA-N
SMILESCOC1(CCCCC1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)