Products 1535312-81-2

CAS 1535312-81-2 appears in our catalog under these names: 2-(Cyclopentylmethoxy)ethane-1-sulfonyl chloride, 2-(Cyclopentylmethoxy)ethane-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.

2-(cyclopentylmethoxy)ethanesulfonyl chloride (CAS 1535312-81-2) is a chemical compound with the molecular formula C8H15ClO3S and a molecular weight of 226.72 g/mol. IUPAC name: 2-(cyclopentylmethoxy)ethanesulfonyl chloride. InChIKey: XUULMOBJJUZANO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClO3S
Molecular weight226.72 g/mol
IUPAC name2-(cyclopentylmethoxy)ethanesulfonyl chloride
InChIKeyXUULMOBJJUZANO-UHFFFAOYSA-N
SMILESC1CCC(C1)COCCS(=O)(=O)Cl

Computed by PubChem (NCBI)