CAS 1505399-49-4 appears in our catalog under these names: 2-(4-Bromo-2-chlorophenyl)-2-methylpropan-1-amine, 95%, 2-(4-Bromo-2-chlorophenyl)-2-methylpropan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
2-(4-bromo-2-chlorophenyl)-2-methylpropan-1-amine (CAS 1505399-49-4) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: 2-(4-bromo-2-chlorophenyl)-2-methylpropan-1-amine. InChIKey: OWLXQIYRTGQRPI-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | 2-(4-bromo-2-chlorophenyl)-2-methylpropan-1-amine |
| InChIKey | OWLXQIYRTGQRPI-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)