CAS 1506047-42-2 is the registry number for 3-((3-Fluorophenyl)sulfanyl)-2-hydroxy-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(3-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid (CAS 1506047-42-2) is a chemical compound with the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. IUPAC name: 3-(3-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid. InChIKey: FXKDJQPJFWKUJT-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3S |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 3-(3-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid |
| InChIKey | FXKDJQPJFWKUJT-UHFFFAOYSA-N |
| SMILES | CC(CSC1=CC=CC(=C1)F)(C(=O)O)O |
Computed by PubChem (NCBI)