Products 2624417-93-0
CAS 2624417-93-0 appears in our catalog under these names: 3-Ethoxy-4-fluoro-5-(methylthio)benzoic acid, ≥95%, ≥95%, 3-Ethoxy-4-fluoro-5-(methylthio)benzoic acid, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
3-ethoxy-4-fluoro-5-methylsulfanylbenzoic acid (CAS 2624417-93-0) is a chemical compound with the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. IUPAC name: 3-ethoxy-4-fluoro-5-methylsulfanylbenzoic acid. InChIKey: PUTFNUMODJKOPB-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3S |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 3-ethoxy-4-fluoro-5-methylsulfanylbenzoic acid |
| InChIKey | PUTFNUMODJKOPB-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)C(=O)O)SC)F |
Computed by PubChem (NCBI)