CAS 593960-58-8 is the registry number for 1–(3–Fluoro–4–methanesulfonyl–phenyl)propan–2–one. Offered by: GLPBio. Available pack sizes: 25mg.
1-(3-fluoro-4-methylsulfonylphenyl)propan-2-one (CAS 593960-58-8) is a chemical compound with the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. IUPAC name: 1-(3-fluoro-4-methylsulfonylphenyl)propan-2-one. InChIKey: VZAFQFPMDIGNHW-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3S |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-(3-fluoro-4-methylsulfonylphenyl)propan-2-one |
| InChIKey | VZAFQFPMDIGNHW-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC(=C(C=C1)S(=O)(=O)C)F |
Computed by PubChem (NCBI)