CAS 339530-91-5 is the registry number for 3-((4-Fluorophenyl)thio)-2-hydroxy-2-methylpropanoic acid, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid (CAS 339530-91-5) is a chemical compound with the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. IUPAC name: 3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid. InChIKey: CTYJERNWLVBMTF-UHFFFAOYSA-N.
| Molecular formula | C10H11FO3S |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid |
| InChIKey | CTYJERNWLVBMTF-UHFFFAOYSA-N |
| SMILES | CC(CSC1=CC=C(C=C1)F)(C(=O)O)O |
Computed by PubChem (NCBI)