Products 339530-91-5

CAS 339530-91-5 is the registry number for 3-((4-Fluorophenyl)thio)-2-hydroxy-2-methylpropanoic acid, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid (CAS 339530-91-5) is a chemical compound with the molecular formula C10H11FO3S and a molecular weight of 230.26 g/mol. IUPAC name: 3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid. InChIKey: CTYJERNWLVBMTF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FO3S
Molecular weight230.26 g/mol
IUPAC name3-(4-fluorophenyl)sulfanyl-2-hydroxy-2-methylpropanoic acid
InChIKeyCTYJERNWLVBMTF-UHFFFAOYSA-N
SMILESCC(CSC1=CC=C(C=C1)F)(C(=O)O)O

Computed by PubChem (NCBI)