CAS 150617-68-8 is the registry number for 4-Chloro-1-methyl-2-oxo-1,2-dihydroquinoline-3-carbonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
4-chloro-1-methyl-2-oxoquinoline-3-carbonitrile (CAS 150617-68-8) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 4-chloro-1-methyl-2-oxoquinoline-3-carbonitrile. InChIKey: QWNQPEVIEDNHKA-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 4-chloro-1-methyl-2-oxoquinoline-3-carbonitrile |
| InChIKey | QWNQPEVIEDNHKA-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=C(C1=O)C#N)Cl |
Computed by PubChem (NCBI)