CAS 1506589-76-9 is the registry number for (5-(Pyrazin-2-yl)-1H-1,2,4-triazol-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-pyrazin-2-yl-1H-1,2,4-triazol-5-yl)methanol (CAS 1506589-76-9) is a chemical compound with the molecular formula C7H7N5O and a molecular weight of 177.16 g/mol. IUPAC name: (3-pyrazin-2-yl-1H-1,2,4-triazol-5-yl)methanol. InChIKey: IIIPVDYNDYPEMC-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | (3-pyrazin-2-yl-1H-1,2,4-triazol-5-yl)methanol |
| InChIKey | IIIPVDYNDYPEMC-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NNC(=N2)CO |
Computed by PubChem (NCBI)