CAS 63296-32-2 appears in our catalog under these names: p-Azidobenzoylhydrazide, >95% (HPLC), p-Azidobenzoic acid hydrazide, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg.
4-azidobenzohydrazide (CAS 63296-32-2) is a chemical compound with the molecular formula C7H7N5O and a molecular weight of 177.16 g/mol. IUPAC name: 4-azidobenzohydrazide. InChIKey: YRLKXQVDEQEYSN-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-azidobenzohydrazide |
| InChIKey | YRLKXQVDEQEYSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NN)N=[N+]=[N-] |
Computed by PubChem (NCBI)