CAS 2639625-63-9 is the registry number for pyrazolo[1,5-a]pyrimidine-6-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Pyrazolo[1,5-a]pyrimidine-6-carbohydrazide (CAS 2639625-63-9) is a chemical compound with the molecular formula C7H7N5O and a molecular weight of 177.16 g/mol. IUPAC name: pyrazolo[1,5-a]pyrimidine-6-carbohydrazide. InChIKey: LEEGMPYCSYPZKU-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | pyrazolo[1,5-a]pyrimidine-6-carbohydrazide |
| InChIKey | LEEGMPYCSYPZKU-UHFFFAOYSA-N |
| SMILES | C1=C2N=CC(=CN2N=C1)C(=O)NN |
Computed by PubChem (NCBI)