CAS 708-75-8 appears in our catalog under these names: 6-Methylpterin, 6-Methylpterin, >95% (HPLC), 6–Methylpterin, 6-Methylpterin 95%, 2-Amino-6-methylpteridin-4(3H)-one, 95%, 95%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 100mg, 1g, 50mg, 250mg, 5g, 250 mg, 500 mg.
2-amino-6-methyl-3H-pteridin-4-one (CAS 708-75-8) is a chemical compound with the molecular formula C7H7N5O and a molecular weight of 177.16 g/mol. IUPAC name: 2-amino-6-methyl-3H-pteridin-4-one. InChIKey: UDOGNMDURIJYQC-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-amino-6-methyl-3H-pteridin-4-one |
| InChIKey | UDOGNMDURIJYQC-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)