Products 15069-79-1
CAS 15069-79-1 appears in our catalog under these names: 5,6-Diacetoxyindole, 95%, 5,6-Diacetoxyindole, 98%, 5，6–Diacetoxyindole, 5,6-Diacetoxyindole, >98.0%(HPLC)(N), 5,6-Diacetoxyindole. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 250mg, 200mg.
(6-acetyloxy-1H-indol-5-yl) acetate (CAS 15069-79-1) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: (6-acetyloxy-1H-indol-5-yl) acetate. InChIKey: NTOLUQGMBCPVOZ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | (6-acetyloxy-1H-indol-5-yl) acetate |
| InChIKey | NTOLUQGMBCPVOZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C2C(=C1)C=CN2)OC(=O)C |
Computed by PubChem (NCBI)