Products 1507295-95-5
CAS 1507295-95-5 is the registry number for tert-butyl 5-bromothiophene-3-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 5-bromothiophene-3-carboxylate (CAS 1507295-95-5) is a chemical compound with the molecular formula C9H11BrO2S and a molecular weight of 263.15 g/mol. IUPAC name: tert-butyl 5-bromothiophene-3-carboxylate. InChIKey: RJRPYIPWMHEHKV-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO2S |
|---|---|
| Molecular weight | 263.15 g/mol |
| IUPAC name | tert-butyl 5-bromothiophene-3-carboxylate |
| InChIKey | RJRPYIPWMHEHKV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CSC(=C1)Br |
Computed by PubChem (NCBI)