CAS 1507350-73-3 is the registry number for 4,6-Dichloro-1-ethyl-1H-pyrrolo[3,2-c]pyridine, >97%, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,6-dichloro-1-ethylpyrrolo[3,2-c]pyridine (CAS 1507350-73-3) is a chemical compound with the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. IUPAC name: 4,6-dichloro-1-ethylpyrrolo[3,2-c]pyridine. InChIKey: QAPGEUIVHFRPTI-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N2 |
|---|---|
| Molecular weight | 215.08 g/mol |
| IUPAC name | 4,6-dichloro-1-ethylpyrrolo[3,2-c]pyridine |
| InChIKey | QAPGEUIVHFRPTI-UHFFFAOYSA-N |
| SMILES | CCN1C=CC2=C(N=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)