Products 150783-39-4
CAS 150783-39-4 is the registry number for N-(4-Chloro-2-nitrophenyl)-2,2-dimethylpropanamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-(4-chloro-2-nitrophenyl)-2,2-dimethylpropanamide (CAS 150783-39-4) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: N-(4-chloro-2-nitrophenyl)-2,2-dimethylpropanamide. InChIKey: IOGMTRJJIWRGJR-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | N-(4-chloro-2-nitrophenyl)-2,2-dimethylpropanamide |
| InChIKey | IOGMTRJJIWRGJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(C=C(C=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)