Products 1507931-22-7

CAS 1507931-22-7 is the registry number for 7-Chloro-8-methyl-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-chloro-8-methyl-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 1507931-22-7) is a chemical compound with the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. IUPAC name: 7-chloro-8-methyl-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: JPYIWBZBVVHSBR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12ClNO2
Molecular weight225.67 g/mol
IUPAC name7-chloro-8-methyl-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
InChIKeyJPYIWBZBVVHSBR-UHFFFAOYSA-N
SMILESCC1=C(C=CC2=C1NCCC2C(=O)O)Cl

Computed by PubChem (NCBI)