Products 1508878-66-7
CAS 1508878-66-7 is the registry number for 8-Bromo-5-chloro-1,2,3,4-tetrahydroquinoline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-bromo-5-chloro-1,2,3,4-tetrahydroquinoline (CAS 1508878-66-7) is a chemical compound with the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. IUPAC name: 8-bromo-5-chloro-1,2,3,4-tetrahydroquinoline. InChIKey: MAJJEJCDRHIFTL-UHFFFAOYSA-N.
| Molecular formula | C9H9BrClN |
|---|---|
| Molecular weight | 246.53 g/mol |
| IUPAC name | 8-bromo-5-chloro-1,2,3,4-tetrahydroquinoline |
| InChIKey | MAJJEJCDRHIFTL-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2NC1)Br)Cl |
Computed by PubChem (NCBI)