CAS 15089-73-3 appears in our catalog under these names: 1-(2-Chloro-4,5-dimethylphenyl)ethan-1-one, 95%, 1-(2-Chloro-4,5-dimethylphenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2-chloro-4,5-dimethylphenyl)ethanone (CAS 15089-73-3) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 1-(2-chloro-4,5-dimethylphenyl)ethanone. InChIKey: SLYHPKAWFFEWPU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 1-(2-chloro-4,5-dimethylphenyl)ethanone |
| InChIKey | SLYHPKAWFFEWPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)Cl)C(=O)C |
Computed by PubChem (NCBI)