CAS 1509338-41-3 appears in our catalog under these names: 6-Bromo-4-fluoro-2-methyl-2,3-dihydro-1H-inden-1-one, 97%, 6-Bromo-4-fluoro-2-methyl-2,3-dihydro-1H-inden-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-bromo-4-fluoro-2-methyl-2,3-dihydroinden-1-one (CAS 1509338-41-3) is a chemical compound with the molecular formula C10H8BrFO and a molecular weight of 243.07 g/mol. IUPAC name: 6-bromo-4-fluoro-2-methyl-2,3-dihydroinden-1-one. InChIKey: KLPCRILKSWGTQF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO |
|---|---|
| Molecular weight | 243.07 g/mol |
| IUPAC name | 6-bromo-4-fluoro-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | KLPCRILKSWGTQF-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C=C(C=C2F)Br |
Computed by PubChem (NCBI)