CAS 881189-81-7 is the registry number for 4-Bromo-6-fluoro-5-methyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-6-fluoro-5-methyl-2,3-dihydroinden-1-one (CAS 881189-81-7) is a chemical compound with the molecular formula C10H8BrFO and a molecular weight of 243.07 g/mol. IUPAC name: 4-bromo-6-fluoro-5-methyl-2,3-dihydroinden-1-one. InChIKey: UAKDQAKUGPAMON-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO |
|---|---|
| Molecular weight | 243.07 g/mol |
| IUPAC name | 4-bromo-6-fluoro-5-methyl-2,3-dihydroinden-1-one |
| InChIKey | UAKDQAKUGPAMON-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1Br)CCC2=O)F |
Computed by PubChem (NCBI)