CAS 2314440-27-0 is the registry number for 2-Bromo-5-fluoro-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-fluoro-3,4-dihydro-2H-naphthalen-1-one (CAS 2314440-27-0) is a chemical compound with the molecular formula C10H8BrFO and a molecular weight of 243.07 g/mol. IUPAC name: 2-bromo-5-fluoro-3,4-dihydro-2H-naphthalen-1-one. InChIKey: KOBZYAWIXJMUMZ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFO |
|---|---|
| Molecular weight | 243.07 g/mol |
| IUPAC name | 2-bromo-5-fluoro-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | KOBZYAWIXJMUMZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC=C2F)C(=O)C1Br |
Computed by PubChem (NCBI)