Products 203194-33-6
CAS 203194-33-6 is the registry number for (3E)-4-(5-Bromo-2-fluorophenyl)but-3-en-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
(E)-4-(5-bromo-2-fluorophenyl)but-3-en-2-one (CAS 203194-33-6) is a chemical compound with the molecular formula C10H8BrFO and a molecular weight of 243.07 g/mol. IUPAC name: (E)-4-(5-bromo-2-fluorophenyl)but-3-en-2-one. InChIKey: ZSOMEPSFKDCBMZ-NSCUHMNNSA-N.
| Molecular formula | C10H8BrFO |
|---|---|
| Molecular weight | 243.07 g/mol |
| IUPAC name | (E)-4-(5-bromo-2-fluorophenyl)but-3-en-2-one |
| InChIKey | ZSOMEPSFKDCBMZ-NSCUHMNNSA-N |
| SMILES | CC(=O)/C=C/C1=C(C=CC(=C1)Br)F |
Computed by PubChem (NCBI)