CAS 1509338-85-5 is the registry number for Methyl 4-chloro-6,7-dihydro-5H-cyclopenta(d)pyrimidine-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
Methyl 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate (CAS 1509338-85-5) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: methyl 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate. InChIKey: IQANMKDYMZCHOG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | methyl 4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2-carboxylate |
| InChIKey | IQANMKDYMZCHOG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(CCC2)C(=N1)Cl |
Computed by PubChem (NCBI)