Products 1510828-97-3
CAS 1510828-97-3 is the registry number for rel-1-(tert-Butyl) 4-ethyl (3R,4S)-3-aminopiperidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-ethyl (3R,4S)-3-aminopiperidine-1,4-dicarboxylate (CAS 1510828-97-3) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (3R,4S)-3-aminopiperidine-1,4-dicarboxylate. InChIKey: HWBQJXRREBQWDK-UWVGGRQHSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (3R,4S)-3-aminopiperidine-1,4-dicarboxylate |
| InChIKey | HWBQJXRREBQWDK-UWVGGRQHSA-N |
| SMILES | CCOC(=O)[C@H]1CCN(C[C@@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)