CAS 2281850-52-8 appears in our catalog under these names: 1-(tert-Butyl) 4-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate, 97%, O1-Tert-Butyl O4-Ethyl (3R,4R)-3-Aminopiperidine-1,4-Dicarboxylate, 97%, 1-TERT-BUTYL 4-ETHYL (3R,4R)-3-AMINOPIPERIDINE-1,4-DICARBOXYLATE, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
1-O-tert-butyl 4-O-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate (CAS 2281850-52-8) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate. InChIKey: HWBQJXRREBQWDK-ZJUUUORDSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate |
| InChIKey | HWBQJXRREBQWDK-ZJUUUORDSA-N |
| SMILES | CCOC(=O)[C@@H]1CCN(C[C@@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)