CAS 2410955-49-4 appears in our catalog under these names: Rel-1-(tert-butyl) 4-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate, 98%, rac-1-tert-butyl 4-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 500mg.
1-O-tert-butyl 4-O-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate (CAS 2410955-49-4) is a chemical compound with the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate. InChIKey: HWBQJXRREBQWDK-ZJUUUORDSA-N.
| Molecular formula | C13H24N2O4 |
|---|---|
| Molecular weight | 272.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (3R,4R)-3-aminopiperidine-1,4-dicarboxylate |
| InChIKey | HWBQJXRREBQWDK-ZJUUUORDSA-N |
| SMILES | CCOC(=O)[C@@H]1CCN(C[C@@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)