Products 1510967-49-3

CAS 1510967-49-3 is the registry number for 2-(5,6-Dihydro-4H-pyrrolo[1,2-b]pyrazol-2-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)propanoic acid (CAS 1510967-49-3) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 2-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)propanoic acid. InChIKey: YPCNJTBWGDXTAA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O2
Molecular weight180.20 g/mol
IUPAC name2-(5,6-dihydro-4H-pyrrolo[2,1-e]pyrazol-2-yl)propanoic acid
InChIKeyYPCNJTBWGDXTAA-UHFFFAOYSA-N
SMILESCC(C1=NN2CCCC2=C1)C(=O)O

Computed by PubChem (NCBI)