CAS 15116-41-3 appears in our catalog under these names: Brexpiprazole Impurity 41, Brexpiprazole Impurity 10, Brexpiprazole Impurity 52. Offered by: Hubei YoungXin, Chemat Brand, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 5mg.
(E)-N-(3-methoxyphenyl)-3-phenylprop-2-enamide (CAS 15116-41-3) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: (E)-N-(3-methoxyphenyl)-3-phenylprop-2-enamide. InChIKey: GVTLFGJNTIRUEG-ZHACJKMWSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (E)-N-(3-methoxyphenyl)-3-phenylprop-2-enamide |
| InChIKey | GVTLFGJNTIRUEG-ZHACJKMWSA-N |
| SMILES | COC1=CC=CC(=C1)NC(=O)/C=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)