Products 1512061-05-0

CAS 1512061-05-0 is the registry number for 3-(3-Fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid (CAS 1512061-05-0) is a chemical compound with the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. IUPAC name: 3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid. InChIKey: CFSSIEJMVLAGAP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11FO4
Molecular weight214.19 g/mol
IUPAC name3-(3-fluoro-4-methoxyphenyl)-2-hydroxypropanoic acid
InChIKeyCFSSIEJMVLAGAP-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)CC(C(=O)O)O)F

Computed by PubChem (NCBI)